Excel® Column A holds user inputs for Bird clear sky model in rows 6 to 29. Note the cell references rely on the exact structure of rows and columns shown. User values are entered in shaded cells. Bold text are labels for values to be entered in cell below label.
TABLE A.1
Bird Clear Sky Input Parameters
Row Number Column A, Label, Value, or Function 1 2
|
3 4 5 |
N/A |
|
6 |
USER |
|
7 |
INPUTS |
|
8 |
Latitude |
|
9 |
User Value (+N, – S) |
|
10 |
Longitude |
|
11 |
User Value (+E, – W) |
|
12 |
Time Zone |
|
13 |
User Value (-W, +E) |
|
14 |
Station Pressure mB |
|
15 |
User Value |
|
16 |
Ozone atm-cm |
|
17 |
User Value (0.0-0.35) |
|
18 |
Water Vapor H2O atm-cm |
|
19 |
User Value (0.0-6.0) |
|
20 |
Aerosol Optical Depth (AOD) @ 500 nm |
|
21 |
User Value (0.0-0.4) |
|
22 |
AOD @ 380 nm |
|
23 |
User value (~1.5 x AOD @ 500 nm) |
|
24 |
Taua (total AOD) |
|
25 |
= 0.2758*$A$23+0.35*$A$21 |
|
26 |
Asymmetry Factor Ba |
|
27 |
0.85 |
|
28 |
Ground Albedo (0.0 to 1.0) |
|
29 |
0.2 |
TABLE A.2
Values and Functions to Be Entered in Row 3, from Columns B to V
|
Column Row 1 |
Row 2 |
Rows 3-8762 |
|
|
B |
DOY |
1 to 365 |
|
|
C |
HR |
0 to 23 |
|
|
D |
Solar Position |
ETR |
= 1367*(1.00011+0.034221*COS(6.28318*(B3-1)/365) +0.00128*SIN(6.28318*(B3-1)/365)+0.000719 *COS(2*(6.28318*(B3-1)/365))+0.000077 *SIN(2*(6.28318*(B3-1)/365))) |
|
E |
Dangle |
= 6.283185*(B3-1)/365 |
|
|
F |
DEC |
= (0.006918-0.399912*COS(E3)+0.070257*SIN(E3) -0.006758*COS(2*E3)+0.000907*SIN(2*E3) -0.002697*COS(3*E3)+0.00148*SIN(3*E3)) *(180/3.14159) |
|
|
G |
EQT |
= (0.000075+0.001868*COS(E3)-0.032077*SIN(E3) -0.014615*COS(2*E3)-0.040849*SIN(2*E3))*(229.18) |
|
|
H |
Hour Angle |
= 15*((C3-0.5)-$A$13-12)+$A$11+G3/4 |
|
|
I |
Zenith Angle |
= ACOS(COS(F3/(180/3.14159))*COS($A$9/(180/3.14159)) *COS(H3/(180/3.14159))+SIN(F3/(180/3.14159)) *SIN($A$9/(180/3.14159)))*(180/3.14159) |
|
|
J |
Air Mass |
= IF(I3<89,1/(COS(I3/(180/3.14159)) +0.15/(93.885-I3)A1.25),0) |
|
|
K |
Transmittances |
T Rayleigh |
= IF(J3>0,EXP(-0.0903*($A$15/1013)A0.84 *(1+$A$15/1013-($A$15/1013)A1.01)),0) |
|
L |
T Ozone |
= IF(J3>0,1-0.1611*($A$17*J3)*(1+139.48*($A$17*J3))a -0.3034-0.002715*($A$17*J3)/(1+0.044*($A$17*J3) +0.0003*($A$17*J3)A2),0) |
|
|
M |
T Gases |
= IF(J3>0,EXP(-0.0127*(J3*$A$15/1013)A0.26),0) |
|
|
N |
T Water |
= IF(J3>0,1-2.4959*J3*$A$19/((1+79.034*$A$19*J3) A0.6828+6.385*$A$19*J3),0) |
|
|
O |
T Aerosol |
= IF(J3>0,EXP(-($A$25A0.873) *(1+$A$25-$A$25A0.7088)*J3A0.918),0) |
|
|
P |
TAA |
= IF(J3>0,1-0.1*(1-J3+J3A1.06)*(1-O3),0) |
|
|
Q |
Intermediate Results |
Rs |
= IF(J3>0,0.0685+(1-$A$27)*(1-O3/P3),0) |
|
R |
Id |
= IF(J3>0,0.9662*D3*O3*N3*M3*L3*K3,0) |
|
|
S |
IdnH |
= IF(I3<90,R3*COS(I3/(180/3.14159)),0) |
|
|
T |
Ias |
= IF(J3>0,D3*COS(I3/(180/3.14159))*0.79*L3*M3*N3*P3 *(0.5*(1-K3)+$A$27*(1-(O3/P3))/(1-J3+(J3)A1.02)),0) |
|
|
U |
GH |
= IF(J3>0,(S3+T3)/(1-$A$29*Q3),0) |
|
|
V |
Decimal |
Time |
= B3+(C3-0.5)/24 |
|
W |
MODEL RESULT (W/M2) |
Direct Beam |
= R3 |
|
X |
Direct Hz |
= S3 |
|
|
Y |
Global Hz |
= U3 |
|
|
Z |
Diffuse Hz |
= Y3-X3 |
|
|
Note: |
Text in columns 2 and 3 |
are simply labels to be entered into designated cell row/column location. |
|
|
Column 3 contains functions with references to row 3 cell contents, to be copied to the rows following. |
